C12H29N3 — CID 20606517
7-methylundecane-1,5,11-triamine (PubChem CID 20606517) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is 7-methylundecane-1,5,11-triamine.
| Compound Name | 7-methylundecane-1,5,11-triamine |
|---|---|
| PubChem CID | 20606517 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | 7-methylundecane-1,5,11-triamine |
| SMILES | CC(CCCCN)CC(N)CCCCN |
| InChI | InChI=1S/C12H29N3/c1-11(6-2-4-8-13)10-12(15)7-3-5-9-14/h11-12H,2-10,13-15H2,1H3 |
| InChIKey | RWVLJKAAETZYKJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|