C32H32N2O4 — CID 20606632
(4-methylphenyl) 4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)-1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 20606632) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is (4-methylphenyl) 4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)-1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (4-methylphenyl) 4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)-1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 20606632 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (4-methylphenyl) 4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)-1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2cc(NC3CCC4CCCCC4C3)c3c(c2N)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C32H32N2O4/c1-18-10-14-22(15-11-18)38-32(37)25-17-26(34-21-13-12-19-6-2-3-7-20(19)16-21)27-28(29(25)33)31(36)24-9-5-4-8-23(24)30(27)35/h4-5,8-11,14-15,17,19-21,34H,2-3,6-7,12-13,16,33H2,1H3 |
| InChIKey | MSLPZWQDTBIOCO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|