About CID 20606810
CID 20606810 (PubChem CID 20606810) has the molecular formula C30H21AlNO2
and a molecular weight of 454.49 g/mol.
Molecular Properties
| Compound Name | CID 20606810 |
| PubChem CID | 20606810 |
| Molecular Formula | C30H21AlNO2 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cccnc2c1O[Al]Oc1ccc(-c2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C20H14O.C10H9NO.Al/c21-20-13-12-18(17-9-3-4-10-19(17)20)16-11-5-7-14-6-1-2-8-15(14)16;1-7-4-5-8-3-2-6-11-9(8)10(7)12;/h1-13,21H;2-6,12H,1H3;/q;;+2/p-2 |
| InChIKey | GGSPVLOVAVWSOR-UHFFFAOYSA-L |
| XLogP | 7.51 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 20606810 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20606810?
The IUPAC name of CID 20606810 (CID 20606810) is not available.
What is the SMILES notation for CID 20606810?
The canonical SMILES for CID 20606810 is Cc1ccc2cccnc2c1O[Al]Oc1ccc(-c2cccc3ccccc23)c2ccccc12.
What is the InChIKey of CID 20606810?
The InChIKey is GGSPVLOVAVWSOR-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H14O.C10H9NO.Al/c21-20-13-12-18(17-9-3-4-10-19(17)20)16-11-5-7-14-6-1-2-8-15(14)16;1-7-4-5-8-3-2-6-11-9(8)10(7)12;/h1-13,21H;2-6,12H,1H3;/q;;+2/p-2.
What are the key properties of CID 20606810?
CID 20606810 has a molecular weight of 454.49 g/mol, XLogP of 7.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20606810 is sourced from PubChem (CID 20606810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).