C49H28N8S4 — CID 20606862
2-[4-[tris[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]methyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 20606862) has the molecular formula C49H28N8S4 and a molecular weight of 857.09 g/mol. Its IUPAC name is 2-[4-[tris[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]methyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-[4-[tris[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]methyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 20606862 |
| Molecular Formula | C49H28N8S4 |
| Molecular Weight | 857.09 g/mol |
| Exact Mass | 856.13 |
| IUPAC Name | 2-[4-[tris[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]methyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | c1cnc2sc(-c3ccc(C(c4ccc(-c5nc6cccnc6s5)cc4)(c4ccc(-c5nc6cccnc6s5)cc4)c4ccc(-c5nc6cccnc6s5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C49H28N8S4/c1-5-37-45(50-25-1)58-41(54-37)29-9-17-33(18-10-29)49(34-19-11-30(12-20-34)42-55-38-6-2-26-51-46(38)59-42,35-21-13-31(14-22-35)43-56-39-7-3-27-52-47(39)60-43)36-23-15-32(16-24-36)44-57-40-8-4-28-53-48(40)61-44/h1-28H |
| InChIKey | ULZMVDTVDWFBDO-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.09 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|