C54H34N12 — CID 20606867
3-phenyl-2-[2,4,5-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)phenyl]imidazo[4,5-b]pyridine (PubChem CID 20606867) has the molecular formula C54H34N12 and a molecular weight of 850.95 g/mol. Its IUPAC name is 3-phenyl-2-[2,4,5-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)phenyl]imidazo[4,5-b]pyridine.
| Compound Name | 3-phenyl-2-[2,4,5-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)phenyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 20606867 |
| Molecular Formula | C54H34N12 |
| Molecular Weight | 850.95 g/mol |
| Exact Mass | 850.30 |
| IUPAC Name | 3-phenyl-2-[2,4,5-tris(3-phenylimidazo[4,5-b]pyridin-2-yl)phenyl]imidazo[4,5-b]pyridine |
| SMILES | c1ccc(-n2c(-c3cc(-c4nc5cccnc5n4-c4ccccc4)c(-c4nc5cccnc5n4-c4ccccc4)cc3-c3nc4cccnc4n3-c3ccccc3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C54H34N12/c1-5-17-35(18-6-1)63-47(59-43-25-13-29-55-51(43)63)39-33-41(49-61-45-27-15-31-57-53(45)65(49)37-21-9-3-10-22-37)42(50-62-46-28-16-32-58-54(46)66(50)38-23-11-4-12-24-38)34-40(39)48-60-44-26-14-30-56-52(44)64(48)36-19-7-2-8-20-36/h1-34H |
| InChIKey | AOBAODXEXNCQDR-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 122.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.95 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |