About [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate
[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate (PubChem CID 20608168) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate.
Molecular Properties
| Compound Name | [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate |
| PubChem CID | 20608168 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate |
| SMILES | CC(=O)OC(CC1CC2CC1C(C)C2C)C1CCOC1=O |
| InChI | InChI=1S/C17H26O4/c1-9-10(2)15-7-12(9)6-13(15)8-16(21-11(3)18)14-4-5-20-17(14)19/h9-10,12-16H,4-8H2,1-3H3 |
| InChIKey | GMAWZFLQTUKGIP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate?
The IUPAC name of [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate (CID 20608168) is [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate.
What is the SMILES notation for [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate?
The canonical SMILES for [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate is CC(=O)OC(CC1CC2CC1C(C)C2C)C1CCOC1=O.
What is the InChIKey of [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate?
The InChIKey is GMAWZFLQTUKGIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4/c1-9-10(2)15-7-12(9)6-13(15)8-16(21-11(3)18)14-4-5-20-17(14)19/h9-10,12-16H,4-8H2,1-3H3.
What are the key properties of [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate?
[2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate has a molecular weight of 294.39 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-1-(2-oxooxolan-3-yl)ethyl] acetate is sourced from PubChem (CID 20608168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).