C17H23Cl3O4 — CID 20608180
[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-(2-oxooxan-3-yl)methyl] 2,2,2-trichloroacetate (PubChem CID 20608180) has the molecular formula C17H23Cl3O4 and a molecular weight of 397.73 g/mol. Its IUPAC name is [(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-(2-oxooxan-3-yl)methyl] 2,2,2-trichloroacetate.
| Compound Name | [(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-(2-oxooxan-3-yl)methyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 20608180 |
| Molecular Formula | C17H23Cl3O4 |
| Molecular Weight | 397.73 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-(2-oxooxan-3-yl)methyl] 2,2,2-trichloroacetate |
| SMILES | CC1C2CC(C1C)C(C(OC(=O)C(Cl)(Cl)Cl)C1CCCOC1=O)C2 |
| InChI | InChI=1S/C17H23Cl3O4/c1-8-9(2)12-6-10(8)7-13(12)14(24-16(22)17(18,19)20)11-4-3-5-23-15(11)21/h8-14H,3-7H2,1-2H3 |
| InChIKey | YHDJCYTVZPDGQG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|