C21H30O4 — CID 20608186
[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-(2-oxooxolan-3-yl)methyl] acetate (PubChem CID 20608186) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-(2-oxooxolan-3-yl)methyl] acetate.
| Compound Name | [(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-(2-oxooxolan-3-yl)methyl] acetate |
|---|---|
| PubChem CID | 20608186 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-(2-oxooxolan-3-yl)methyl] acetate |
| SMILES | CC(=O)OC(C1CCOC1=O)C1CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C21H30O4/c1-9-10(2)15-8-14(9)18-12-6-16(19(15)18)17(7-12)20(25-11(3)22)13-4-5-24-21(13)23/h9-10,12-20H,4-8H2,1-3H3 |
| InChIKey | LWEWBOMGYQFOSS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|