About oct-1-ynylboronic acid
oct-1-ynylboronic acid (PubChem CID 20608212) has the molecular formula C8H15BO2
and a molecular weight of 154.02 g/mol. Its IUPAC name is oct-1-ynylboronic acid.
Molecular Properties
| Compound Name | oct-1-ynylboronic acid |
| PubChem CID | 20608212 |
| Molecular Formula | C8H15BO2 |
| Molecular Weight | 154.02 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | oct-1-ynylboronic acid |
| SMILES | CCCCCCC#CB(O)O |
| InChI | InChI=1S/C8H15BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-6H2,1H3 |
| InChIKey | NEPFJBQNFDKJTP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.02 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-1-ynylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-ynylboronic acid?
The IUPAC name of oct-1-ynylboronic acid (CID 20608212) is oct-1-ynylboronic acid.
What is the SMILES notation for oct-1-ynylboronic acid?
The canonical SMILES for oct-1-ynylboronic acid is CCCCCCC#CB(O)O.
What is the InChIKey of oct-1-ynylboronic acid?
The InChIKey is NEPFJBQNFDKJTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-6H2,1H3.
What are the key properties of oct-1-ynylboronic acid?
oct-1-ynylboronic acid has a molecular weight of 154.02 g/mol, XLogP of 0.97, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-ynylboronic acid is sourced from PubChem (CID 20608212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).