C11H6F5N3O2 — CID 2060885
5-methyl-3-nitro-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazole (PubChem CID 2060885) has the molecular formula C11H6F5N3O2 and a molecular weight of 307.18 g/mol. Its IUPAC name is 5-methyl-3-nitro-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazole.
| Compound Name | 5-methyl-3-nitro-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 2060885 |
| Molecular Formula | C11H6F5N3O2 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 5-methyl-3-nitro-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazole |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H6F5N3O2/c1-4-2-6(19(20)21)17-18(4)3-5-7(12)9(14)11(16)10(15)8(5)13/h2H,3H2,1H3 |
| InChIKey | BOOUZYOQMASAGI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|