C20H36N2O2 — CID 20609188
3-methyl-4-(3-methylpentyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 20609188) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 3-methyl-4-(3-methylpentyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-4-(3-methylpentyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 20609188 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 3-methyl-4-(3-methylpentyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CCC(C)CCC1C(=O)N(C2CC(C)(C)NC(C)(C)C2)C(=O)C1C |
| InChI | InChI=1S/C20H36N2O2/c1-8-13(2)9-10-16-14(3)17(23)22(18(16)24)15-11-19(4,5)21-20(6,7)12-15/h13-16,21H,8-12H2,1-7H3 |
| InChIKey | HGLMNQDCZJUNGQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|