About 4-methylheptan-2-yl prop-2-enoate
4-methylheptan-2-yl prop-2-enoate (PubChem CID 20609198) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-methylheptan-2-yl prop-2-enoate.
Molecular Properties
| Compound Name | 4-methylheptan-2-yl prop-2-enoate |
| PubChem CID | 20609198 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 4-methylheptan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CC(C)CCC |
| InChI | InChI=1S/C11H20O2/c1-5-7-9(3)8-10(4)13-11(12)6-2/h6,9-10H,2,5,7-8H2,1,3-4H3 |
| InChIKey | RENUSXIQTFULJU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylheptan-2-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptan-2-yl prop-2-enoate?
The IUPAC name of 4-methylheptan-2-yl prop-2-enoate (CID 20609198) is 4-methylheptan-2-yl prop-2-enoate.
What is the SMILES notation for 4-methylheptan-2-yl prop-2-enoate?
The canonical SMILES for 4-methylheptan-2-yl prop-2-enoate is C=CC(=O)OC(C)CC(C)CCC.
What is the InChIKey of 4-methylheptan-2-yl prop-2-enoate?
The InChIKey is RENUSXIQTFULJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-7-9(3)8-10(4)13-11(12)6-2/h6,9-10H,2,5,7-8H2,1,3-4H3.
What are the key properties of 4-methylheptan-2-yl prop-2-enoate?
4-methylheptan-2-yl prop-2-enoate has a molecular weight of 184.28 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptan-2-yl prop-2-enoate is sourced from PubChem (CID 20609198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).