About 3,5-bis(isocyanatomethyl)-1,4-thiaselenane
3,5-bis(isocyanatomethyl)-1,4-thiaselenane (PubChem CID 20609248) has the molecular formula C8H10N2O2SSe
and a molecular weight of 277.21 g/mol. Its IUPAC name is 3,5-bis(isocyanatomethyl)-1,4-thiaselenane.
Molecular Properties
| Compound Name | 3,5-bis(isocyanatomethyl)-1,4-thiaselenane |
| PubChem CID | 20609248 |
| Molecular Formula | C8H10N2O2SSe |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | 3,5-bis(isocyanatomethyl)-1,4-thiaselenane |
| SMILES | O=C=NCC1CSCC(CN=C=O)[Se]1 |
| InChI | InChI=1S/C8H10N2O2SSe/c11-5-9-1-7-3-13-4-8(14-7)2-10-6-12/h7-8H,1-4H2 |
| InChIKey | VWZYRFBLZYGQBC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(isocyanatomethyl)-1,4-thiaselenane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(isocyanatomethyl)-1,4-thiaselenane?
The IUPAC name of 3,5-bis(isocyanatomethyl)-1,4-thiaselenane (CID 20609248) is 3,5-bis(isocyanatomethyl)-1,4-thiaselenane.
What is the SMILES notation for 3,5-bis(isocyanatomethyl)-1,4-thiaselenane?
The canonical SMILES for 3,5-bis(isocyanatomethyl)-1,4-thiaselenane is O=C=NCC1CSCC(CN=C=O)[Se]1.
What is the InChIKey of 3,5-bis(isocyanatomethyl)-1,4-thiaselenane?
The InChIKey is VWZYRFBLZYGQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2SSe/c11-5-9-1-7-3-13-4-8(14-7)2-10-6-12/h7-8H,1-4H2.
What are the key properties of 3,5-bis(isocyanatomethyl)-1,4-thiaselenane?
3,5-bis(isocyanatomethyl)-1,4-thiaselenane has a molecular weight of 277.21 g/mol, XLogP of 0.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(isocyanatomethyl)-1,4-thiaselenane is sourced from PubChem (CID 20609248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).