C18H14BrF2N5OS — CID 2060929
N-(2-bromo-4,6-difluorophenyl)-2-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 2060929) has the molecular formula C18H14BrF2N5OS and a molecular weight of 466.31 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-2-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-2-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2060929 |
| Molecular Formula | C18H14BrF2N5OS |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-2-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2c(F)cc(F)cc2Br)nnc1-c1ccccn1 |
| InChI | InChI=1S/C18H14BrF2N5OS/c1-2-7-26-17(14-5-3-4-6-22-14)24-25-18(26)28-10-15(27)23-16-12(19)8-11(20)9-13(16)21/h2-6,8-9H,1,7,10H2,(H,23,27) |
| InChIKey | PLSCIEWXYUUSIX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|