About 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione
5-(4,4-dimethylpentyl)imidazolidine-2,4-dione (PubChem CID 20609400) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione |
| PubChem CID | 20609400 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)CCCC1NC(=O)NC1=O |
| InChI | InChI=1S/C10H18N2O2/c1-10(2,3)6-4-5-7-8(13)12-9(14)11-7/h7H,4-6H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | NWHVPDBPMUCCIF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione?
The IUPAC name of 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione (CID 20609400) is 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione?
The canonical SMILES for 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione is CC(C)(C)CCCC1NC(=O)NC1=O.
What is the InChIKey of 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione?
The InChIKey is NWHVPDBPMUCCIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-10(2,3)6-4-5-7-8(13)12-9(14)11-7/h7H,4-6H2,1-3H3,(H2,11,12,13,14).
What are the key properties of 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione?
5-(4,4-dimethylpentyl)imidazolidine-2,4-dione has a molecular weight of 198.27 g/mol, XLogP of 1.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-dimethylpentyl)imidazolidine-2,4-dione is sourced from PubChem (CID 20609400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).