C24H33N6O6+3 — CID 20609498
6,15,23-triisocyanato-7,9,17-triazoniatrispiro[6.1.69.1.617.17]tetracosane-8,16,24-trione (PubChem CID 20609498) has the molecular formula C24H33N6O6+3 and a molecular weight of 501.56 g/mol. Its IUPAC name is 6,15,23-triisocyanato-7,9,17-triazoniatrispiro[6.1.69.1.617.17]tetracosane-8,16,24-trione.
| Compound Name | 6,15,23-triisocyanato-7,9,17-triazoniatrispiro[6.1.69.1.617.17]tetracosane-8,16,24-trione |
|---|---|
| PubChem CID | 20609498 |
| Molecular Formula | C24H33N6O6+3 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 6,15,23-triisocyanato-7,9,17-triazoniatrispiro[6.1.69.1.617.17]tetracosane-8,16,24-trione |
| SMILES | O=C=NC1CCCCC[N+]12C(=O)[N+]1(CCCCCC1N=C=O)C(=O)[N+]1(CCCCCC1N=C=O)C2=O |
| InChI | InChI=1S/C24H33N6O6/c31-16-25-19-10-4-1-7-13-28(19)22(34)29(14-8-2-5-11-20(29)26-17-32)24(36)30(23(28)35)15-9-3-6-12-21(30)27-18-33/h19-21H,1-15H2/q+3 |
| InChIKey | QFFJUMPARAQIGE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 139.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|