C35H56O12 — CID 20609606
1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]propyl 3-hexyl-6-[8-oxo-8-[1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]propoxy]octyl]cyclohex-3-ene-1-carboxylate (PubChem CID 20609606) has the molecular formula C35H56O12 and a molecular weight of 668.82 g/mol. Its IUPAC name is 1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]propyl 3-hexyl-6-[8-oxo-8-[1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]propoxy]octyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]propyl 3-hexyl-6-[8-oxo-8-[1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]propoxy]octyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 20609606 |
| Molecular Formula | C35H56O12 |
| Molecular Weight | 668.82 g/mol |
| Exact Mass | 668.38 |
| IUPAC Name | 1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]propyl 3-hexyl-6-[8-oxo-8-[1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]propoxy]octyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CCCCCCC1=CCC(CCCCCCCC(=O)OC(CC)OCC2COC(=O)O2)C(C(=O)OC(CC)OCC2COC(=O)O2)C1 |
| InChI | InChI=1S/C35H56O12/c1-4-7-8-12-15-25-18-19-26(29(20-25)33(37)47-32(6-3)41-22-28-24-43-35(39)45-28)16-13-10-9-11-14-17-30(36)46-31(5-2)40-21-27-23-42-34(38)44-27/h18,26-29,31-32H,4-17,19-24H2,1-3H3 |
| InChIKey | LKPPULKECADNPT-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.82 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|