About (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene
(5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene (PubChem CID 20609696) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene.
Molecular Properties
| Compound Name | (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene |
| PubChem CID | 20609696 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene |
| SMILES | C=C(C)CC/C=C(\C)COCSC |
| InChI | InChI=1S/C11H20OS/c1-10(2)6-5-7-11(3)8-12-9-13-4/h7H,1,5-6,8-9H2,2-4H3/b11-7+ |
| InChIKey | FUNCKQOKCGGNKT-YRNVUSSQSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene?
The IUPAC name of (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene (CID 20609696) is (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene.
What is the SMILES notation for (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene?
The canonical SMILES for (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene is C=C(C)CC/C=C(\C)COCSC.
What is the InChIKey of (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene?
The InChIKey is FUNCKQOKCGGNKT-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H20OS/c1-10(2)6-5-7-11(3)8-12-9-13-4/h7H,1,5-6,8-9H2,2-4H3/b11-7+.
What are the key properties of (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene?
(5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene has a molecular weight of 200.35 g/mol, XLogP of 3.63, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2,6-dimethyl-7-(methylsulfanylmethoxy)hepta-1,5-diene is sourced from PubChem (CID 20609696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).