About [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol
[[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol (PubChem CID 20609703) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol.
Molecular Properties
| Compound Name | [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol |
| PubChem CID | 20609703 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol |
| SMILES | C=C(C)CC/C=C(\C)CNCO |
| InChI | InChI=1S/C10H19NO/c1-9(2)5-4-6-10(3)7-11-8-12/h6,11-12H,1,4-5,7-8H2,2-3H3/b10-6+ |
| InChIKey | JQUKUEBKNMACQO-UXBLZVDNSA-N |
| XLogP | 1.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol?
The IUPAC name of [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol (CID 20609703) is [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol.
What is the SMILES notation for [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol?
The canonical SMILES for [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol is C=C(C)CC/C=C(\C)CNCO.
What is the InChIKey of [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol?
The InChIKey is JQUKUEBKNMACQO-UXBLZVDNSA-N. The full InChI is InChI=1S/C10H19NO/c1-9(2)5-4-6-10(3)7-11-8-12/h6,11-12H,1,4-5,7-8H2,2-3H3/b10-6+.
What are the key properties of [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol?
[[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol has a molecular weight of 169.27 g/mol, XLogP of 1.83, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2E)-2,6-dimethylhepta-2,6-dienyl]amino]methanol is sourced from PubChem (CID 20609703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).