About methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+)
methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+) (PubChem CID 20609735) has the molecular formula C6H12OSY+
and a molecular weight of 221.13 g/mol. Its IUPAC name is methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+).
Molecular Properties
| Compound Name | methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+) |
| PubChem CID | 20609735 |
| Molecular Formula | C6H12OSY+ |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.97 |
| IUPAC Name | methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+) |
| SMILES | [CH2-]SC.[H]/[C-]=C(/C)CO.[Y+3] |
| InChI | InChI=1S/C4H7O.C2H5S.Y/c1-4(2)3-5;1-3-2;/h1,5H,3H2,2H3;1H2,2H3;/q2*-1;+3 |
| InChIKey | ITHOAYWUJLNYOR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+)?
The IUPAC name of methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+) (CID 20609735) is methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+).
What is the SMILES notation for methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+)?
The canonical SMILES for methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+) is [CH2-]SC.[H]/[C-]=C(/C)CO.[Y+3].
What is the InChIKey of methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+)?
The InChIKey is ITHOAYWUJLNYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O.C2H5S.Y/c1-4(2)3-5;1-3-2;/h1,5H,3H2,2H3;1H2,2H3;/q2*-1;+3.
What are the key properties of methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+)?
methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+) has a molecular weight of 221.13 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanidylsulfanylmethane;2-methylprop-2-en-1-ol;yttrium(3+) is sourced from PubChem (CID 20609735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).