About methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+)
methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+) (PubChem CID 20609775) has the molecular formula C21H21PSY+
and a molecular weight of 425.35 g/mol. Its IUPAC name is methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+).
Molecular Properties
| Compound Name | methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+) |
| PubChem CID | 20609775 |
| Molecular Formula | C21H21PSY+ |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+) |
| SMILES | [CH2-]SC.[H][C-]=P(c1ccccc1)(c1ccccc1)c1ccccc1.[Y+3] |
| InChI | InChI=1S/C19H16P.C2H5S.Y/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-3-2;/h1-16H;1H2,2H3;/q2*-1;+3 |
| InChIKey | AYXXVRXZXMMLKA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+)?
The IUPAC name of methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+) (CID 20609775) is methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+).
What is the SMILES notation for methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+)?
The canonical SMILES for methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+) is [CH2-]SC.[H][C-]=P(c1ccccc1)(c1ccccc1)c1ccccc1.[Y+3].
What is the InChIKey of methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+)?
The InChIKey is AYXXVRXZXMMLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16P.C2H5S.Y/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-3-2;/h1-16H;1H2,2H3;/q2*-1;+3.
What are the key properties of methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+)?
methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+) has a molecular weight of 425.35 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanidylidene(triphenyl)-λ5-phosphane;methanidylsulfanylmethane;yttrium(3+) is sourced from PubChem (CID 20609775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).