About ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate
ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate (PubChem CID 20609968) has the molecular formula C18H23F2NO3
and a molecular weight of 339.38 g/mol. Its IUPAC name is ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate |
| PubChem CID | 20609968 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)C1CCC(F)(F)CC1)c1ccccc1 |
| InChI | InChI=1S/C18H23F2NO3/c1-2-24-16(22)12-15(13-6-4-3-5-7-13)21-17(23)14-8-10-18(19,20)11-9-14/h3-7,14-15H,2,8-12H2,1H3,(H,21,23) |
| InChIKey | FYXMBQHPFFJHKH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate?
The IUPAC name of ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate (CID 20609968) is ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate.
What is the SMILES notation for ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate?
The canonical SMILES for ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate is CCOC(=O)CC(NC(=O)C1CCC(F)(F)CC1)c1ccccc1.
What is the InChIKey of ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate?
The InChIKey is FYXMBQHPFFJHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F2NO3/c1-2-24-16(22)12-15(13-6-4-3-5-7-13)21-17(23)14-8-10-18(19,20)11-9-14/h3-7,14-15H,2,8-12H2,1H3,(H,21,23).
What are the key properties of ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate?
ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate has a molecular weight of 339.38 g/mol, XLogP of 3.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate is sourced from PubChem (CID 20609968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).