About 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]
1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane] (PubChem CID 20610107) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane].
Molecular Properties
| Compound Name | 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane] |
| PubChem CID | 20610107 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane] |
| SMILES | c1ccc(C23CCC4(CC2C3)OCCO4)cc1 |
| InChI | InChI=1S/C15H18O2/c1-2-4-12(5-3-1)14-6-7-15(11-13(14)10-14)16-8-9-17-15/h1-5,13H,6-11H2 |
| InChIKey | DRBBLIJOYRBAPT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]?
The IUPAC name of 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane] (CID 20610107) is 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane].
What is the SMILES notation for 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]?
The canonical SMILES for 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane] is c1ccc(C23CCC4(CC2C3)OCCO4)cc1.
What is the InChIKey of 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]?
The InChIKey is DRBBLIJOYRBAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c1-2-4-12(5-3-1)14-6-7-15(11-13(14)10-14)16-8-9-17-15/h1-5,13H,6-11H2.
What are the key properties of 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]?
1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane] has a molecular weight of 230.31 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-phenylspiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane] is sourced from PubChem (CID 20610107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).