C21H32N4O4S — CID 20610116
3-[1-(3-acetylphenyl)piperidin-4-yl]-1-methyl-1-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 20610116) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-[1-(3-acetylphenyl)piperidin-4-yl]-1-methyl-1-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 3-[1-(3-acetylphenyl)piperidin-4-yl]-1-methyl-1-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 20610116 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-[1-(3-acetylphenyl)piperidin-4-yl]-1-methyl-1-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | CC(=O)c1cccc(N2CCC(NC(=O)N(C)C3CCN(S(C)(=O)=O)CC3)CC2)c1 |
| InChI | InChI=1S/C21H32N4O4S/c1-16(26)17-5-4-6-20(15-17)24-11-7-18(8-12-24)22-21(27)23(2)19-9-13-25(14-10-19)30(3,28)29/h4-6,15,18-19H,7-14H2,1-3H3,(H,22,27) |
| InChIKey | ZQGLVPVLNNTXIS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |