C13H27F2N3 — CID 20610174
11,11-difluoro-1,7-dimethyl-1,4,7-triazacyclotetradecane (PubChem CID 20610174) has the molecular formula C13H27F2N3 and a molecular weight of 263.38 g/mol. Its IUPAC name is 11,11-difluoro-1,7-dimethyl-1,4,7-triazacyclotetradecane.
| Compound Name | 11,11-difluoro-1,7-dimethyl-1,4,7-triazacyclotetradecane |
|---|---|
| PubChem CID | 20610174 |
| Molecular Formula | C13H27F2N3 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 11,11-difluoro-1,7-dimethyl-1,4,7-triazacyclotetradecane |
| SMILES | CN1CCCC(F)(F)CCCN(C)CCNCC1 |
| InChI | InChI=1S/C13H27F2N3/c1-17-9-3-5-13(14,15)6-4-10-18(2)12-8-16-7-11-17/h16H,3-12H2,1-2H3 |
| InChIKey | ZODBSKALYIXNON-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |