C13H29N3O — CID 20610194
5,8,11-trimethyl-1-oxa-5,8,11-triazacyclotetradecane (PubChem CID 20610194) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 5,8,11-trimethyl-1-oxa-5,8,11-triazacyclotetradecane.
| Compound Name | 5,8,11-trimethyl-1-oxa-5,8,11-triazacyclotetradecane |
|---|---|
| PubChem CID | 20610194 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 5,8,11-trimethyl-1-oxa-5,8,11-triazacyclotetradecane |
| SMILES | CN1CCCOCCCN(C)CCN(C)CC1 |
| InChI | InChI=1S/C13H29N3O/c1-14-6-4-12-17-13-5-7-15(2)9-11-16(3)10-8-14/h4-13H2,1-3H3 |
| InChIKey | JBCROGZIDGRINK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |