C35H45FO6S — CID 20611040
5-[(7R,8S,9S,13S,14S)-11-fluoro-13-methyl-3-(oxan-2-yloxy)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]pentyl 4-methylbenzenesulfonate (PubChem CID 20611040) has the molecular formula C35H45FO6S and a molecular weight of 612.80 g/mol. Its IUPAC name is 5-[(7R,8S,9S,13S,14S)-11-fluoro-13-methyl-3-(oxan-2-yloxy)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]pentyl 4-methylbenzenesulfonate.
| Compound Name | 5-[(7R,8S,9S,13S,14S)-11-fluoro-13-methyl-3-(oxan-2-yloxy)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]pentyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 20611040 |
| Molecular Formula | C35H45FO6S |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | 5-[(7R,8S,9S,13S,14S)-11-fluoro-13-methyl-3-(oxan-2-yloxy)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]pentyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCC[C@@H]2Cc3cc(OC4CCCCO4)ccc3[C@H]3C(F)C[C@]4(C)C(=O)CC[C@H]4[C@H]23)cc1 |
| InChI | InChI=1S/C35H45FO6S/c1-23-10-13-27(14-11-23)43(38,39)41-19-6-3-4-8-24-20-25-21-26(42-32-9-5-7-18-40-32)12-15-28(25)34-30(36)22-35(2)29(33(24)34)16-17-31(35)37/h10-15,21,24,29-30,32-34H,3-9,16-20,22H2,1-2H3/t24-,29+,30?,32?,33+,34+,35+/m1/s1 |
| InChIKey | MMPKCUQAPNLAIM-NWLJMDAASA-N |
| XLogP | 7.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|