C23H33N3O5SSi — CID 20611231
(4S,5R,6S)-3-[7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylimidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 20611231) has the molecular formula C23H33N3O5SSi and a molecular weight of 491.69 g/mol. Its IUPAC name is (4S,5R,6S)-3-[7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylimidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4S,5R,6S)-3-[7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylimidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 20611231 |
| Molecular Formula | C23H33N3O5SSi |
| Molecular Weight | 491.69 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (4S,5R,6S)-3-[7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylimidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | Cc1nc(CO[Si](C)(C)C(C)(C)C)c2sc(C3=C(C(=O)O)N4C(=O)[C@H]([C@@H](C)O)[C@H]4[C@H]3C)cn12 |
| InChI | InChI=1S/C23H33N3O5SSi/c1-11-16(19(22(29)30)26-18(11)17(12(2)27)20(26)28)15-9-25-13(3)24-14(21(25)32-15)10-31-33(7,8)23(4,5)6/h9,11-12,17-18,27H,10H2,1-8H3,(H,29,30)/t11-,12+,17+,18+/m0/s1 |
| InChIKey | FTTIBYGONIULON-PCHOHSICSA-N |
| XLogP | 3.88 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.69 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|