C24H23Cl4N3O6S2 — CID 20611552
[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(sulfomethyl)benzimidazol-2-ylidene]prop-1-enyl]-1-ethylindol-3-yl]methanesulfonic acid (PubChem CID 20611552) has the molecular formula C24H23Cl4N3O6S2 and a molecular weight of 655.41 g/mol. Its IUPAC name is [5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(sulfomethyl)benzimidazol-2-ylidene]prop-1-enyl]-1-ethylindol-3-yl]methanesulfonic acid.
| Compound Name | [5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(sulfomethyl)benzimidazol-2-ylidene]prop-1-enyl]-1-ethylindol-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 20611552 |
| Molecular Formula | C24H23Cl4N3O6S2 |
| Molecular Weight | 655.41 g/mol |
| Exact Mass | 652.98 |
| IUPAC Name | [5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(sulfomethyl)benzimidazol-2-ylidene]prop-1-enyl]-1-ethylindol-3-yl]methanesulfonic acid |
| SMILES | CCN1/C(=C/C=C/c2c(CS(=O)(=O)O)c3cc(Cl)c(Cl)cc3n2CC)N(CS(=O)(=O)O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C24H23Cl4N3O6S2/c1-3-29-20(15(12-38(32,33)34)14-8-16(25)17(26)9-21(14)29)6-5-7-24-30(4-2)22-10-18(27)19(28)11-23(22)31(24)13-39(35,36)37/h5-11H,3-4,12-13H2,1-2H3,(H,32,33,34)(H,35,36,37)/b6-5+,24-7- |
| InChIKey | YQHZGANOKVDSMJ-MPTIVFRESA-N |
| XLogP | 6.71 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.41 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|