C30H27N3O — CID 20611881
(2Z)-2-[6'-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]spiro[1,3-dihydroindene-2,2'-3H-pyran]-4'-ylidene]-2-isocyanoacetonitrile (PubChem CID 20611881) has the molecular formula C30H27N3O and a molecular weight of 445.57 g/mol. Its IUPAC name is (2Z)-2-[6'-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]spiro[1,3-dihydroindene-2,2'-3H-pyran]-4'-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[6'-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]spiro[1,3-dihydroindene-2,2'-3H-pyran]-4'-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 20611881 |
| Molecular Formula | C30H27N3O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (2Z)-2-[6'-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]spiro[1,3-dihydroindene-2,2'-3H-pyran]-4'-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(/C=C/c2cc3c4c(c2)CCCN4CCC3)OC2(C1)Cc1ccccc1C2 |
| InChI | InChI=1S/C30H27N3O/c1-32-28(20-31)26-16-27(34-30(19-26)17-24-6-2-3-7-25(24)18-30)11-10-21-14-22-8-4-12-33-13-5-9-23(15-21)29(22)33/h2-3,6-7,10-11,14-16H,4-5,8-9,12-13,17-19H2/b11-10+,28-26+ |
| InChIKey | XYDUVZRMHXBXDP-WLCFXYKVSA-N |
| XLogP | 5.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|