About (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate
(5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate (PubChem CID 20612653) has the molecular formula C8H7F3O4
and a molecular weight of 224.13 g/mol. Its IUPAC name is (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 20612653 |
| Molecular Formula | C8H7F3O4 |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC1COC(=O)C1)C(F)(F)F |
| InChI | InChI=1S/C8H7F3O4/c1-4(8(9,10)11)7(13)15-5-2-6(12)14-3-5/h5H,1-3H2 |
| InChIKey | NKJVYKBYKQJUML-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate (CID 20612653) is (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate is C=C(C(=O)OC1COC(=O)C1)C(F)(F)F.
What is the InChIKey of (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is NKJVYKBYKQJUML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O4/c1-4(8(9,10)11)7(13)15-5-2-6(12)14-3-5/h5H,1-3H2.
What are the key properties of (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate?
(5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 224.13 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxooxolan-3-yl) 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 20612653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).