About 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine
2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine (PubChem CID 20613676) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine |
| PubChem CID | 20613676 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine |
| SMILES | COC1=CC(CCN)C=CC1 |
| InChI | InChI=1S/C9H15NO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-3,7-8H,4-6,10H2,1H3 |
| InChIKey | MCVBXAIAZXEEBC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine?
The IUPAC name of 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine (CID 20613676) is 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine.
What is the SMILES notation for 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine?
The canonical SMILES for 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine is COC1=CC(CCN)C=CC1.
What is the InChIKey of 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine?
The InChIKey is MCVBXAIAZXEEBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-3,7-8H,4-6,10H2,1H3.
What are the key properties of 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine?
2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine has a molecular weight of 153.22 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxycyclohexa-2,5-dien-1-yl)ethanamine is sourced from PubChem (CID 20613676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).