About O-(2-phenylethyl) ethanethioate
O-(2-phenylethyl) ethanethioate (PubChem CID 20613832) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is O-(2-phenylethyl) ethanethioate.
Molecular Properties
| Compound Name | O-(2-phenylethyl) ethanethioate |
| PubChem CID | 20613832 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | O-(2-phenylethyl) ethanethioate |
| SMILES | CC(=S)OCCc1ccccc1 |
| InChI | InChI=1S/C10H12OS/c1-9(12)11-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | CQGGPYGGOANVNO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-phenylethyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-phenylethyl) ethanethioate?
The IUPAC name of O-(2-phenylethyl) ethanethioate (CID 20613832) is O-(2-phenylethyl) ethanethioate.
What is the SMILES notation for O-(2-phenylethyl) ethanethioate?
The canonical SMILES for O-(2-phenylethyl) ethanethioate is CC(=S)OCCc1ccccc1.
What is the InChIKey of O-(2-phenylethyl) ethanethioate?
The InChIKey is CQGGPYGGOANVNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-9(12)11-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3.
What are the key properties of O-(2-phenylethyl) ethanethioate?
O-(2-phenylethyl) ethanethioate has a molecular weight of 180.27 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-phenylethyl) ethanethioate is sourced from PubChem (CID 20613832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).