C8H11N — CID 20614425
4,5,6,7-tetrahydro-3aH-indole (PubChem CID 20614425) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-3aH-indole.
| Compound Name | 4,5,6,7-tetrahydro-3aH-indole |
|---|---|
| PubChem CID | 20614425 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 4,5,6,7-tetrahydro-3aH-indole |
| SMILES | C1=CC2CCCCC2=N1 |
| InChI | InChI=1S/C8H11N/c1-2-4-8-7(3-1)5-6-9-8/h5-7H,1-4H2 |
| InChIKey | NDRYGFLPJIMCGA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |