About 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide
3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide (PubChem CID 20614523) has the molecular formula C10H18ClNO
and a molecular weight of 203.71 g/mol. Its IUPAC name is 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide |
| PubChem CID | 20614523 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide |
| SMILES | CC(C)NC(=O)C1(C)CC(C)(Cl)C1 |
| InChI | InChI=1S/C10H18ClNO/c1-7(2)12-8(13)9(3)5-10(4,11)6-9/h7H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | SHDXYWZUVGWQAW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide?
The IUPAC name of 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide (CID 20614523) is 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide.
What is the SMILES notation for 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide?
The canonical SMILES for 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide is CC(C)NC(=O)C1(C)CC(C)(Cl)C1.
What is the InChIKey of 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide?
The InChIKey is SHDXYWZUVGWQAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClNO/c1-7(2)12-8(13)9(3)5-10(4,11)6-9/h7H,5-6H2,1-4H3,(H,12,13).
What are the key properties of 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide?
3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide has a molecular weight of 203.71 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,3-dimethyl-N-propan-2-ylcyclobutane-1-carboxamide is sourced from PubChem (CID 20614523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).