C13H20O2 — CID 20614815
4,4,5,5,6,6-hexamethyl-2-methylidenecyclohexane-1,3-dione (PubChem CID 20614815) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexamethyl-2-methylidenecyclohexane-1,3-dione.
| Compound Name | 4,4,5,5,6,6-hexamethyl-2-methylidenecyclohexane-1,3-dione |
|---|---|
| PubChem CID | 20614815 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4,4,5,5,6,6-hexamethyl-2-methylidenecyclohexane-1,3-dione |
| SMILES | C=C1C(=O)C(C)(C)C(C)(C)C(C)(C)C1=O |
| InChI | InChI=1S/C13H20O2/c1-8-9(14)11(2,3)13(6,7)12(4,5)10(8)15/h1H2,2-7H3 |
| InChIKey | GQGGCONABXPMGS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|