About 2-(fluoromethoxy)hexane
2-(fluoromethoxy)hexane (PubChem CID 20614891) has the molecular formula C7H15FO
and a molecular weight of 134.19 g/mol. Its IUPAC name is 2-(fluoromethoxy)hexane.
Molecular Properties
| Compound Name | 2-(fluoromethoxy)hexane |
| PubChem CID | 20614891 |
| Molecular Formula | C7H15FO |
| Molecular Weight | 134.19 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 2-(fluoromethoxy)hexane |
| SMILES | CCCCC(C)OCF |
| InChI | InChI=1S/C7H15FO/c1-3-4-5-7(2)9-6-8/h7H,3-6H2,1-2H3 |
| InChIKey | NDDLLRXDOCKNRU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(fluoromethoxy)hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethoxy)hexane?
The IUPAC name of 2-(fluoromethoxy)hexane (CID 20614891) is 2-(fluoromethoxy)hexane.
What is the SMILES notation for 2-(fluoromethoxy)hexane?
The canonical SMILES for 2-(fluoromethoxy)hexane is CCCCC(C)OCF.
What is the InChIKey of 2-(fluoromethoxy)hexane?
The InChIKey is NDDLLRXDOCKNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15FO/c1-3-4-5-7(2)9-6-8/h7H,3-6H2,1-2H3.
What are the key properties of 2-(fluoromethoxy)hexane?
2-(fluoromethoxy)hexane has a molecular weight of 134.19 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethoxy)hexane is sourced from PubChem (CID 20614891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).