C8H21N4O2P — CID 20614905
3-hydroxy-1,5,8,11-tetraza-3λ5-phosphacyclotridecane 3-oxide (PubChem CID 20614905) has the molecular formula C8H21N4O2P and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-hydroxy-1,5,8,11-tetraza-3λ5-phosphacyclotridecane 3-oxide.
| Compound Name | 3-hydroxy-1,5,8,11-tetraza-3λ5-phosphacyclotridecane 3-oxide |
|---|---|
| PubChem CID | 20614905 |
| Molecular Formula | C8H21N4O2P |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-hydroxy-1,5,8,11-tetraza-3λ5-phosphacyclotridecane 3-oxide |
| SMILES | O=P1(O)CNCCNCCNCCNC1 |
| InChI | InChI=1S/C8H21N4O2P/c13-15(14)7-11-5-3-9-1-2-10-4-6-12-8-15/h9-12H,1-8H2,(H,13,14) |
| InChIKey | QOGMPNNTRWAXGF-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|