About 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate
2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate (PubChem CID 20614989) has the molecular formula C17H29ClO5
and a molecular weight of 348.87 g/mol. Its IUPAC name is 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate.
Molecular Properties
| Compound Name | 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate |
| PubChem CID | 20614989 |
| Molecular Formula | C17H29ClO5 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate |
| SMILES | CCC1COC(COC2CCC(CCOC(=O)CCl)CC2)OC1 |
| InChI | InChI=1S/C17H29ClO5/c1-2-13-10-22-17(23-11-13)12-21-15-5-3-14(4-6-15)7-8-20-16(19)9-18/h13-15,17H,2-12H2,1H3 |
| InChIKey | URIWXAAPVYEEQR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate?
The IUPAC name of 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate (CID 20614989) is 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate.
What is the SMILES notation for 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate?
The canonical SMILES for 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate is CCC1COC(COC2CCC(CCOC(=O)CCl)CC2)OC1.
What is the InChIKey of 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate?
The InChIKey is URIWXAAPVYEEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29ClO5/c1-2-13-10-22-17(23-11-13)12-21-15-5-3-14(4-6-15)7-8-20-16(19)9-18/h13-15,17H,2-12H2,1H3.
What are the key properties of 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate?
2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate has a molecular weight of 348.87 g/mol, XLogP of 3.13, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(5-ethyl-1,3-dioxan-2-yl)methoxy]cyclohexyl]ethyl 2-chloroacetate is sourced from PubChem (CID 20614989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).