C25H22F8O4 — CID 20615024
[3-fluoro-4-[4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexyl]phenyl] 2,6-difluoro-4-propylbenzoate (PubChem CID 20615024) has the molecular formula C25H22F8O4 and a molecular weight of 538.43 g/mol. Its IUPAC name is [3-fluoro-4-[4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexyl]phenyl] 2,6-difluoro-4-propylbenzoate.
| Compound Name | [3-fluoro-4-[4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexyl]phenyl] 2,6-difluoro-4-propylbenzoate |
|---|---|
| PubChem CID | 20615024 |
| Molecular Formula | C25H22F8O4 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | [3-fluoro-4-[4-(2,2,3,3,3-pentafluoropropanoyloxy)cyclohexyl]phenyl] 2,6-difluoro-4-propylbenzoate |
| SMILES | CCCc1cc(F)c(C(=O)Oc2ccc(C3CCC(OC(=O)C(F)(F)C(F)(F)F)CC3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H22F8O4/c1-2-3-13-10-19(27)21(20(28)11-13)22(34)36-16-8-9-17(18(26)12-16)14-4-6-15(7-5-14)37-23(35)24(29,30)25(31,32)33/h8-12,14-15H,2-7H2,1H3 |
| InChIKey | WLTKDVFNHSZXGY-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|