C19H25F5O4 — CID 20615231
[4-[5-[(1E)-hexa-1,5-dienyl]-1,3-dioxan-2-yl]cyclohexyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 20615231) has the molecular formula C19H25F5O4 and a molecular weight of 412.40 g/mol. Its IUPAC name is [4-[5-[(1E)-hexa-1,5-dienyl]-1,3-dioxan-2-yl]cyclohexyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[5-[(1E)-hexa-1,5-dienyl]-1,3-dioxan-2-yl]cyclohexyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 20615231 |
| Molecular Formula | C19H25F5O4 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [4-[5-[(1E)-hexa-1,5-dienyl]-1,3-dioxan-2-yl]cyclohexyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | C=CCC/C=C/C1COC(C2CCC(OC(=O)C(F)(F)C(F)(F)F)CC2)OC1 |
| InChI | InChI=1S/C19H25F5O4/c1-2-3-4-5-6-13-11-26-16(27-12-13)14-7-9-15(10-8-14)28-17(25)18(20,21)19(22,23)24/h2,5-6,13-16H,1,3-4,7-12H2/b6-5+ |
| InChIKey | DLOQWGXDMZZXPY-AATRIKPKSA-N |
| XLogP | 4.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|