About [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate
[4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate (PubChem CID 20615237) has the molecular formula C16H27FO4
and a molecular weight of 302.39 g/mol. Its IUPAC name is [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate.
Molecular Properties
| Compound Name | [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate |
| PubChem CID | 20615237 |
| Molecular Formula | C16H27FO4 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate |
| SMILES | CCCC1COC(C2CCC(OC(=O)CCF)CC2)OC1 |
| InChI | InChI=1S/C16H27FO4/c1-2-3-12-10-19-16(20-11-12)13-4-6-14(7-5-13)21-15(18)8-9-17/h12-14,16H,2-11H2,1H3 |
| InChIKey | GNYHVPHOZJREGC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate?
The IUPAC name of [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate (CID 20615237) is [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate.
What is the SMILES notation for [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate?
The canonical SMILES for [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate is CCCC1COC(C2CCC(OC(=O)CCF)CC2)OC1.
What is the InChIKey of [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate?
The InChIKey is GNYHVPHOZJREGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27FO4/c1-2-3-12-10-19-16(20-11-12)13-4-6-14(7-5-13)21-15(18)8-9-17/h12-14,16H,2-11H2,1H3.
What are the key properties of [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate?
[4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate has a molecular weight of 302.39 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 3-fluoropropanoate is sourced from PubChem (CID 20615237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).