About [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate
[4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate (PubChem CID 20615238) has the molecular formula C18H28F2O4
and a molecular weight of 346.41 g/mol. Its IUPAC name is [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate.
Molecular Properties
| Compound Name | [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate |
| PubChem CID | 20615238 |
| Molecular Formula | C18H28F2O4 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate |
| SMILES | CCCC1COC(C2CCC(OC(=O)CCC=C(F)F)CC2)OC1 |
| InChI | InChI=1S/C18H28F2O4/c1-2-4-13-11-22-18(23-12-13)14-7-9-15(10-8-14)24-17(21)6-3-5-16(19)20/h5,13-15,18H,2-4,6-12H2,1H3 |
| InChIKey | IZAHTVSQAINFFH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate?
The IUPAC name of [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate (CID 20615238) is [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate.
What is the SMILES notation for [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate?
The canonical SMILES for [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate is CCCC1COC(C2CCC(OC(=O)CCC=C(F)F)CC2)OC1.
What is the InChIKey of [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate?
The InChIKey is IZAHTVSQAINFFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28F2O4/c1-2-4-13-11-22-18(23-12-13)14-7-9-15(10-8-14)24-17(21)6-3-5-16(19)20/h5,13-15,18H,2-4,6-12H2,1H3.
What are the key properties of [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate?
[4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate has a molecular weight of 346.41 g/mol, XLogP of 4.44, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl] 5,5-difluoropent-4-enoate is sourced from PubChem (CID 20615238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).