About [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate
[5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate (PubChem CID 20615281) has the molecular formula C19H31F3O4
and a molecular weight of 380.45 g/mol. Its IUPAC name is [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate.
Molecular Properties
| Compound Name | [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate |
| PubChem CID | 20615281 |
| Molecular Formula | C19H31F3O4 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate |
| SMILES | O=C(OC1OCC(C2CCC(CCCCCCCF)CC2)CO1)C(F)F |
| InChI | InChI=1S/C19H31F3O4/c20-11-5-3-1-2-4-6-14-7-9-15(10-8-14)16-12-24-19(25-13-16)26-18(23)17(21)22/h14-17,19H,1-13H2 |
| InChIKey | JDTAZNWHQZQKRG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate?
The IUPAC name of [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate (CID 20615281) is [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate.
What is the SMILES notation for [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate?
The canonical SMILES for [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate is O=C(OC1OCC(C2CCC(CCCCCCCF)CC2)CO1)C(F)F.
What is the InChIKey of [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate?
The InChIKey is JDTAZNWHQZQKRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31F3O4/c20-11-5-3-1-2-4-6-14-7-9-15(10-8-14)16-12-24-19(25-13-16)26-18(23)17(21)22/h14-17,19H,1-13H2.
What are the key properties of [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate?
[5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate has a molecular weight of 380.45 g/mol, XLogP of 4.86, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[4-(7-fluoroheptyl)cyclohexyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate is sourced from PubChem (CID 20615281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).