C16H21F5O4 — CID 20615306
[5-(4-propylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 20615306) has the molecular formula C16H21F5O4 and a molecular weight of 372.33 g/mol. Its IUPAC name is [5-(4-propylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [5-(4-propylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 20615306 |
| Molecular Formula | C16H21F5O4 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [5-(4-propylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CCCC1=CCC(C2COC(OC(=O)C(F)(F)C(F)(F)F)OC2)CC1 |
| InChI | InChI=1S/C16H21F5O4/c1-2-3-10-4-6-11(7-5-10)12-8-23-14(24-9-12)25-13(22)15(17,18)16(19,20)21/h4,11-12,14H,2-3,5-9H2,1H3 |
| InChIKey | AMBVXLUTSRMRRS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|