C19H25F7O6 — CID 20615316
(5-butyl-1,3-dioxan-2-yl) 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)cyclohexane-1-carboxylate (PubChem CID 20615316) has the molecular formula C19H25F7O6 and a molecular weight of 482.39 g/mol. Its IUPAC name is (5-butyl-1,3-dioxan-2-yl) 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)cyclohexane-1-carboxylate.
| Compound Name | (5-butyl-1,3-dioxan-2-yl) 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20615316 |
| Molecular Formula | C19H25F7O6 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (5-butyl-1,3-dioxan-2-yl) 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)cyclohexane-1-carboxylate |
| SMILES | CCCCC1COC(OC(=O)C2CCC(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)CC2)OC1 |
| InChI | InChI=1S/C19H25F7O6/c1-2-3-4-11-9-29-16(30-10-11)32-14(27)12-5-7-13(8-6-12)31-15(28)17(20,21)18(22,23)19(24,25)26/h11-13,16H,2-10H2,1H3 |
| InChIKey | MWSRHEWIVBGJOT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|