C17H18N2O2S3 — CID 20615551
5-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 20615551) has the molecular formula C17H18N2O2S3 and a molecular weight of 378.54 g/mol. Its IUPAC name is 5-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 20615551 |
| Molecular Formula | C17H18N2O2S3 |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 5-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(=C2Sc3ccc(C(C)(C)C)cc3S2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C17H18N2O2S3/c1-17(2,3)9-6-7-10-11(8-9)24-15(23-10)12-13(20)18(4)16(22)19(5)14(12)21/h6-8H,1-5H3 |
| InChIKey | DIWJBJAGYOWMCH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|