C26H25N5O4S2 — CID 20615743
1-benzyl-6-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]methoxy]-3-hydroxy-3,4-dihydro-2H-quinoline-2-carboxylic acid (PubChem CID 20615743) has the molecular formula C26H25N5O4S2 and a molecular weight of 535.65 g/mol. Its IUPAC name is 1-benzyl-6-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]methoxy]-3-hydroxy-3,4-dihydro-2H-quinoline-2-carboxylic acid.
| Compound Name | 1-benzyl-6-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]methoxy]-3-hydroxy-3,4-dihydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 20615743 |
| Molecular Formula | C26H25N5O4S2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 1-benzyl-6-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]methoxy]-3-hydroxy-3,4-dihydro-2H-quinoline-2-carboxylic acid |
| SMILES | O=C(O)C1C(O)Cc2cc(OCNc3cccc(-n4c(=S)[nH][nH]c4=S)c3)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C26H25N5O4S2/c32-22-12-17-11-20(9-10-21(17)30(23(22)24(33)34)14-16-5-2-1-3-6-16)35-15-27-18-7-4-8-19(13-18)31-25(36)28-29-26(31)37/h1-11,13,22-23,27,32H,12,14-15H2,(H,28,36)(H,29,37)(H,33,34) |
| InChIKey | VIDGKAVHPLYPGJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|