C25H23N6NaO3S — CID 20615744
sodium 1-benzyl-6-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]methoxy]-3,4-dihydro-2H-quinoline-2-carboxylate (PubChem CID 20615744) has the molecular formula C25H23N6NaO3S and a molecular weight of 510.56 g/mol. Its IUPAC name is sodium 1-benzyl-6-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]methoxy]-3,4-dihydro-2H-quinoline-2-carboxylate.
| Compound Name | sodium 1-benzyl-6-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]methoxy]-3,4-dihydro-2H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 20615744 |
| Molecular Formula | C25H23N6NaO3S |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | sodium 1-benzyl-6-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]methoxy]-3,4-dihydro-2H-quinoline-2-carboxylate |
| SMILES | O=C([O-])C1CCc2cc(OCNc3cccc(-n4[nH]nnc4=S)c3)ccc2N1Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C25H24N6O3S.Na/c32-24(33)23-11-9-18-13-21(10-12-22(18)30(23)15-17-5-2-1-3-6-17)34-16-26-19-7-4-8-20(14-19)31-25(35)27-28-29-31;/h1-8,10,12-14,23,26H,9,11,15-16H2,(H,32,33)(H,27,29,35);/q;+1/p-1 |
| InChIKey | GSINSCBEMSASEM-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|