C12H11N5O3S2 — CID 20615788
2-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4,5-dihydroxy-1-methylpyrazol-3-one (PubChem CID 20615788) has the molecular formula C12H11N5O3S2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4,5-dihydroxy-1-methylpyrazol-3-one.
| Compound Name | 2-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4,5-dihydroxy-1-methylpyrazol-3-one |
|---|---|
| PubChem CID | 20615788 |
| Molecular Formula | C12H11N5O3S2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]-4,5-dihydroxy-1-methylpyrazol-3-one |
| SMILES | Cn1c(O)c(O)c(=O)n1-c1ccc(-n2c(=S)[nH][nH]c2=S)cc1 |
| InChI | InChI=1S/C12H11N5O3S2/c1-15-9(19)8(18)10(20)17(15)7-4-2-6(3-5-7)16-11(21)13-14-12(16)22/h2-5,18-19H,1H3,(H,13,21)(H,14,22) |
| InChIKey | UFSNTQUNDHNBIV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|